C8H10N2O4 — CID 71434385
ethyl 3-amino-2-hydroxy-6-oxo-1H-pyridine-4-carboxylate (PubChem CID 71434385) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is ethyl 3-amino-2-hydroxy-6-oxo-1H-pyridine-4-carboxylate.
| Compound Name | ethyl 3-amino-2-hydroxy-6-oxo-1H-pyridine-4-carboxylate |
|---|---|
| PubChem CID | 71434385 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | ethyl 3-amino-2-hydroxy-6-oxo-1H-pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)[nH]c(O)c1N |
| InChI | InChI=1S/C8H10N2O4/c1-2-14-8(13)4-3-5(11)10-7(12)6(4)9/h3H,2,9H2,1H3,(H2,10,11,12) |
| InChIKey | KDUJFDWMSRAUED-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |