C11H13NO5S — CID 135439319
diethyl 2-hydroxy-6-sulfanylidene-1H-pyridine-3,5-dicarboxylate (PubChem CID 135439319) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is diethyl 2-hydroxy-6-sulfanylidene-1H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-hydroxy-6-sulfanylidene-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 135439319 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | diethyl 2-hydroxy-6-sulfanylidene-1H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c(=S)[nH]c1O |
| InChI | InChI=1S/C11H13NO5S/c1-3-16-10(14)6-5-7(11(15)17-4-2)9(18)12-8(6)13/h5H,3-4H2,1-2H3,(H2,12,13,18) |
| InChIKey | LJCCBEAASSBLGC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|