C13H16FN3O2 — CID 70825420
ethyl 2-[(dimethylamino)methyl]-5-fluoro-1H-benzimidazole-4-carboxylate (PubChem CID 70825420) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is ethyl 2-[(dimethylamino)methyl]-5-fluoro-1H-benzimidazole-4-carboxylate.
| Compound Name | ethyl 2-[(dimethylamino)methyl]-5-fluoro-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 70825420 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | ethyl 2-[(dimethylamino)methyl]-5-fluoro-1H-benzimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(F)ccc2[nH]c(CN(C)C)nc12 |
| InChI | InChI=1S/C13H16FN3O2/c1-4-19-13(18)11-8(14)5-6-9-12(11)16-10(15-9)7-17(2)3/h5-6H,4,7H2,1-3H3,(H,15,16) |
| InChIKey | QJYIMHFUUYYBSZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |