C21H23ClN2O3 — CID 163630390
benzyl 6-chloro-4-[(dimethylamino)methyl]-5-hydroxy-2,7-dimethyl-1H-indole-3-carboxylate (PubChem CID 163630390) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is benzyl 6-chloro-4-[(dimethylamino)methyl]-5-hydroxy-2,7-dimethyl-1H-indole-3-carboxylate.
| Compound Name | benzyl 6-chloro-4-[(dimethylamino)methyl]-5-hydroxy-2,7-dimethyl-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 163630390 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | benzyl 6-chloro-4-[(dimethylamino)methyl]-5-hydroxy-2,7-dimethyl-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2c(C)c(Cl)c(O)c(CN(C)C)c2c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-12-18(22)20(25)15(10-24(3)4)17-16(13(2)23-19(12)17)21(26)27-11-14-8-6-5-7-9-14/h5-9,23,25H,10-11H2,1-4H3 |
| InChIKey | HVOHGMLWLDKLOO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|