C18H17Cl4NO3 — CID 88507924
benzyl 2,3,4,6-tetrachloro-5-[2-(dimethylamino)ethoxy]benzoate (PubChem CID 88507924) has the molecular formula C18H17Cl4NO3 and a molecular weight of 437.15 g/mol. Its IUPAC name is benzyl 2,3,4,6-tetrachloro-5-[2-(dimethylamino)ethoxy]benzoate.
| Compound Name | benzyl 2,3,4,6-tetrachloro-5-[2-(dimethylamino)ethoxy]benzoate |
|---|---|
| PubChem CID | 88507924 |
| Molecular Formula | C18H17Cl4NO3 |
| Molecular Weight | 437.15 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | benzyl 2,3,4,6-tetrachloro-5-[2-(dimethylamino)ethoxy]benzoate |
| SMILES | CN(C)CCOc1c(Cl)c(Cl)c(Cl)c(C(=O)OCc2ccccc2)c1Cl |
| InChI | InChI=1S/C18H17Cl4NO3/c1-23(2)8-9-25-17-14(20)12(13(19)15(21)16(17)22)18(24)26-10-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3 |
| InChIKey | QYUVZRWBVWARKR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.15 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|