C18H16O4 — CID 176829212
benzyl 4-hydroxy-5,6-dimethyl-1-benzofuran-7-carboxylate (PubChem CID 176829212) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is benzyl 4-hydroxy-5,6-dimethyl-1-benzofuran-7-carboxylate.
| Compound Name | benzyl 4-hydroxy-5,6-dimethyl-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 176829212 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | benzyl 4-hydroxy-5,6-dimethyl-1-benzofuran-7-carboxylate |
| SMILES | Cc1c(C)c(C(=O)OCc2ccccc2)c2occc2c1O |
| InChI | InChI=1S/C18H16O4/c1-11-12(2)16(19)14-8-9-21-17(14)15(11)18(20)22-10-13-6-4-3-5-7-13/h3-9,19H,10H2,1-2H3 |
| InChIKey | IQFSSQSPOUMIOR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |