C17H16NO6- — CID 25181284
3-ethoxycarbonyl-4-methyl-5-phenylmethoxycarbonyl-1H-pyrrole-2-carboxylate (PubChem CID 25181284) has the molecular formula C17H16NO6- and a molecular weight of 330.32 g/mol. Its IUPAC name is 3-ethoxycarbonyl-4-methyl-5-phenylmethoxycarbonyl-1H-pyrrole-2-carboxylate.
| Compound Name | 3-ethoxycarbonyl-4-methyl-5-phenylmethoxycarbonyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 25181284 |
| Molecular Formula | C17H16NO6- |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-ethoxycarbonyl-4-methyl-5-phenylmethoxycarbonyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C(=O)[O-])[nH]c(C(=O)OCc2ccccc2)c1C |
| InChI | InChI=1S/C17H17NO6/c1-3-23-16(21)12-10(2)13(18-14(12)15(19)20)17(22)24-9-11-7-5-4-6-8-11/h4-8,18H,3,9H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | SWXNYMZEQBOXAG-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |