C18H23NO2 — CID 21051105
benzyl 4-ethyl-3-methyl-5-propan-2-yl-1H-pyrrole-2-carboxylate (PubChem CID 21051105) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is benzyl 4-ethyl-3-methyl-5-propan-2-yl-1H-pyrrole-2-carboxylate.
| Compound Name | benzyl 4-ethyl-3-methyl-5-propan-2-yl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 21051105 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | benzyl 4-ethyl-3-methyl-5-propan-2-yl-1H-pyrrole-2-carboxylate |
| SMILES | CCc1c(C(C)C)[nH]c(C(=O)OCc2ccccc2)c1C |
| InChI | InChI=1S/C18H23NO2/c1-5-15-13(4)17(19-16(15)12(2)3)18(20)21-11-14-9-7-6-8-10-14/h6-10,12,19H,5,11H2,1-4H3 |
| InChIKey | TZKOPTWYBDUIQA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |