C21H19NO3 — CID 1230917
benzyl 5-benzoyl-3,4-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 1230917) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is benzyl 5-benzoyl-3,4-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | benzyl 5-benzoyl-3,4-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 1230917 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | benzyl 5-benzoyl-3,4-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | Cc1c(C(=O)OCc2ccccc2)[nH]c(C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C21H19NO3/c1-14-15(2)19(21(24)25-13-16-9-5-3-6-10-16)22-18(14)20(23)17-11-7-4-8-12-17/h3-12,22H,13H2,1-2H3 |
| InChIKey | QFMFJUQRKUSEGW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |