C21H22ClNO3 — CID 23393880
benzyl 5-(4-chlorobutoxy)-2-methyl-1H-indole-3-carboxylate (PubChem CID 23393880) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is benzyl 5-(4-chlorobutoxy)-2-methyl-1H-indole-3-carboxylate.
| Compound Name | benzyl 5-(4-chlorobutoxy)-2-methyl-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 23393880 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | benzyl 5-(4-chlorobutoxy)-2-methyl-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2ccc(OCCCCCl)cc2c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H22ClNO3/c1-15-20(21(24)26-14-16-7-3-2-4-8-16)18-13-17(9-10-19(18)23-15)25-12-6-5-11-22/h2-4,7-10,13,23H,5-6,11-12,14H2,1H3 |
| InChIKey | ZYBDHVVYOABPRW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|