C17H14F5NO2S — CID 132566619
benzyl 2-methyl-6-(pentafluoro-λ6-sulfanyl)-1H-indole-3-carboxylate (PubChem CID 132566619) has the molecular formula C17H14F5NO2S and a molecular weight of 391.36 g/mol. Its IUPAC name is benzyl 2-methyl-6-(pentafluoro-λ6-sulfanyl)-1H-indole-3-carboxylate.
| Compound Name | benzyl 2-methyl-6-(pentafluoro-λ6-sulfanyl)-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 132566619 |
| Molecular Formula | C17H14F5NO2S |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | benzyl 2-methyl-6-(pentafluoro-λ6-sulfanyl)-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2cc(S(F)(F)(F)(F)F)ccc2c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H14F5NO2S/c1-11-16(17(24)25-10-12-5-3-2-4-6-12)14-8-7-13(9-15(14)23-11)26(18,19,20,21)22/h2-9,23H,10H2,1H3 |
| InChIKey | LJLLMAKXTMPMLJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |