C24H28N2O2 — CID 10110089
benzyl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate (PubChem CID 10110089) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is benzyl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate.
| Compound Name | benzyl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 10110089 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | benzyl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2ccc(CCN3CCCCC3)cc2c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c1-18-23(24(27)28-17-20-8-4-2-5-9-20)21-16-19(10-11-22(21)25-18)12-15-26-13-6-3-7-14-26/h2,4-5,8-11,16,25H,3,6-7,12-15,17H2,1H3 |
| InChIKey | BFIJVSLMFVGDNR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |