C23H27N3O2 — CID 10199610
benzyl 2-methyl-5-(2-pyrrolidin-1-ylethylamino)-1H-indole-3-carboxylate (PubChem CID 10199610) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is benzyl 2-methyl-5-(2-pyrrolidin-1-ylethylamino)-1H-indole-3-carboxylate.
| Compound Name | benzyl 2-methyl-5-(2-pyrrolidin-1-ylethylamino)-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 10199610 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | benzyl 2-methyl-5-(2-pyrrolidin-1-ylethylamino)-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2ccc(NCCN3CCCC3)cc2c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H27N3O2/c1-17-22(23(27)28-16-18-7-3-2-4-8-18)20-15-19(9-10-21(20)25-17)24-11-14-26-12-5-6-13-26/h2-4,7-10,15,24-25H,5-6,11-14,16H2,1H3 |
| InChIKey | FFLNPIGDEBJUAR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |