C18H23NO2 — CID 22311889
5-(2-cyclohexylethyl)-2-methyl-1H-indole-3-carboxylic acid (PubChem CID 22311889) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-(2-cyclohexylethyl)-2-methyl-1H-indole-3-carboxylic acid.
| Compound Name | 5-(2-cyclohexylethyl)-2-methyl-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 22311889 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 5-(2-cyclohexylethyl)-2-methyl-1H-indole-3-carboxylic acid |
| SMILES | Cc1[nH]c2ccc(CCC3CCCCC3)cc2c1C(=O)O |
| InChI | InChI=1S/C18H23NO2/c1-12-17(18(20)21)15-11-14(9-10-16(15)19-12)8-7-13-5-3-2-4-6-13/h9-11,13,19H,2-8H2,1H3,(H,20,21) |
| InChIKey | LBRCFGLJVNPERR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |