C20H30N2O2 — CID 22311939
5-[2-[bis(2-methylpropyl)amino]ethyl]-2-methyl-1H-indole-3-carboxylic acid (PubChem CID 22311939) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 5-[2-[bis(2-methylpropyl)amino]ethyl]-2-methyl-1H-indole-3-carboxylic acid.
| Compound Name | 5-[2-[bis(2-methylpropyl)amino]ethyl]-2-methyl-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 22311939 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 5-[2-[bis(2-methylpropyl)amino]ethyl]-2-methyl-1H-indole-3-carboxylic acid |
| SMILES | Cc1[nH]c2ccc(CCN(CC(C)C)CC(C)C)cc2c1C(=O)O |
| InChI | InChI=1S/C20H30N2O2/c1-13(2)11-22(12-14(3)4)9-8-16-6-7-18-17(10-16)19(20(23)24)15(5)21-18/h6-7,10,13-14,21H,8-9,11-12H2,1-5H3,(H,23,24) |
| InChIKey | MGRSLTPFDLVWPV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |