C28H38N2O2 — CID 10296631
1-(4-tert-butylphenyl)ethyl 5-[2-(diethylamino)ethyl]-2-methyl-1H-indole-3-carboxylate (PubChem CID 10296631) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)ethyl 5-[2-(diethylamino)ethyl]-2-methyl-1H-indole-3-carboxylate.
| Compound Name | 1-(4-tert-butylphenyl)ethyl 5-[2-(diethylamino)ethyl]-2-methyl-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 10296631 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 1-(4-tert-butylphenyl)ethyl 5-[2-(diethylamino)ethyl]-2-methyl-1H-indole-3-carboxylate |
| SMILES | CCN(CC)CCc1ccc2[nH]c(C)c(C(=O)OC(C)c3ccc(C(C)(C)C)cc3)c2c1 |
| InChI | InChI=1S/C28H38N2O2/c1-8-30(9-2)17-16-21-10-15-25-24(18-21)26(19(3)29-25)27(31)32-20(4)22-11-13-23(14-12-22)28(5,6)7/h10-15,18,20,29H,8-9,16-17H2,1-7H3 |
| InChIKey | NENOZIKFUGQMGG-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |