C27H23BrF3N3O5S — CID 87321941
ethyl 6-bromo-1-cyclopropyl-5-hydroxy-4-[(2-methylimidazol-1-yl)methyl]-2-[sulfonyl-[3-(trifluoromethyl)phenyl]methyl]indole-3-carboxylate (PubChem CID 87321941) has the molecular formula C27H23BrF3N3O5S and a molecular weight of 638.46 g/mol. Its IUPAC name is ethyl 6-bromo-1-cyclopropyl-5-hydroxy-4-[(2-methylimidazol-1-yl)methyl]-2-[sulfonyl-[3-(trifluoromethyl)phenyl]methyl]indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-1-cyclopropyl-5-hydroxy-4-[(2-methylimidazol-1-yl)methyl]-2-[sulfonyl-[3-(trifluoromethyl)phenyl]methyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 87321941 |
| Molecular Formula | C27H23BrF3N3O5S |
| Molecular Weight | 638.46 g/mol |
| Exact Mass | 637.05 |
| IUPAC Name | ethyl 6-bromo-1-cyclopropyl-5-hydroxy-4-[(2-methylimidazol-1-yl)methyl]-2-[sulfonyl-[3-(trifluoromethyl)phenyl]methyl]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(c2cccc(C(F)(F)F)c2)=S(=O)=O)n(C2CC2)c2cc(Br)c(O)c(Cn3ccnc3C)c12 |
| InChI | InChI=1S/C27H23BrF3N3O5S/c1-3-39-26(36)22-21-18(13-33-10-9-32-14(33)2)24(35)19(28)12-20(21)34(17-7-8-17)23(22)25(40(37)38)15-5-4-6-16(11-15)27(29,30)31/h4-6,9-12,17,35H,3,7-8,13H2,1-2H3 |
| InChIKey | LRIMSXWJABLASL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|