C25H29BN4O5S2 — CID 123435099
CID 123435099 (PubChem CID 123435099) has the molecular formula C25H29BN4O5S2 and a molecular weight of 540.48 g/mol.
| Compound Name | CID 123435099 |
|---|---|
| PubChem CID | 123435099 |
| Molecular Formula | C25H29BN4O5S2 |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c(c(CN3C/C=N\CCC=C3C)c1O)c(C(=O)OCC)c(CS(=O)(=O)c1nc(C)cs1)n2C |
| InChI | InChI=1S/C25H29BN4O5S2/c1-5-35-24(32)22-20(14-37(33,34)25-28-15(2)13-36-25)29(4)19-11-18(26)23(31)17(21(19)22)12-30-10-9-27-8-6-7-16(30)3/h7,9,11,13,31H,5-6,8,10,12,14H2,1-4H3/b16-7?,27-9- |
| InChIKey | UECSDYSZBDKMFP-NUXRIPPQSA-N |
| XLogP | 2.77 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|