C28H34BrN3O5S — CID 67243500
ethyl 2-(1-adamantylsulfonylmethyl)-6-bromo-5-hydroxy-1-methyl-4-[(2-methylimidazol-2-yl)methyl]indole-3-carboxylate (PubChem CID 67243500) has the molecular formula C28H34BrN3O5S and a molecular weight of 604.57 g/mol. Its IUPAC name is ethyl 2-(1-adamantylsulfonylmethyl)-6-bromo-5-hydroxy-1-methyl-4-[(2-methylimidazol-2-yl)methyl]indole-3-carboxylate.
| Compound Name | ethyl 2-(1-adamantylsulfonylmethyl)-6-bromo-5-hydroxy-1-methyl-4-[(2-methylimidazol-2-yl)methyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 67243500 |
| Molecular Formula | C28H34BrN3O5S |
| Molecular Weight | 604.57 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | ethyl 2-(1-adamantylsulfonylmethyl)-6-bromo-5-hydroxy-1-methyl-4-[(2-methylimidazol-2-yl)methyl]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CS(=O)(=O)C23CC4CC(CC(C4)C2)C3)n(C)c2cc(Br)c(O)c(CC3(C)N=CC=N3)c12 |
| InChI | InChI=1S/C28H34BrN3O5S/c1-4-37-26(34)24-22(15-38(35,36)28-11-16-7-17(12-28)9-18(8-16)13-28)32(3)21-10-20(29)25(33)19(23(21)24)14-27(2)30-5-6-31-27/h5-6,10,16-18,33H,4,7-9,11-15H2,1-3H3 |
| InChIKey | FNUAUCGHIQXCPG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|