C23H24BrN3O8S2 — CID 172857690
ethyl 2-(benzenesulfinylmethyl)-6-bromo-5-hydroxy-4-(imidazol-1-ylmethyl)-1-methylindole-3-carboxylate;sulfuric acid (PubChem CID 172857690) has the molecular formula C23H24BrN3O8S2 and a molecular weight of 614.50 g/mol. Its IUPAC name is ethyl 2-(benzenesulfinylmethyl)-6-bromo-5-hydroxy-4-(imidazol-1-ylmethyl)-1-methylindole-3-carboxylate;sulfuric acid.
| Compound Name | ethyl 2-(benzenesulfinylmethyl)-6-bromo-5-hydroxy-4-(imidazol-1-ylmethyl)-1-methylindole-3-carboxylate;sulfuric acid |
|---|---|
| PubChem CID | 172857690 |
| Molecular Formula | C23H24BrN3O8S2 |
| Molecular Weight | 614.50 g/mol |
| Exact Mass | 613.02 |
| IUPAC Name | ethyl 2-(benzenesulfinylmethyl)-6-bromo-5-hydroxy-4-(imidazol-1-ylmethyl)-1-methylindole-3-carboxylate;sulfuric acid |
| SMILES | CCOC(=O)c1c(CS(=O)c2ccccc2)n(C)c2cc(Br)c(O)c(Cn3ccnc3)c12.O=S(=O)(O)O |
| InChI | InChI=1S/C23H22BrN3O4S.H2O4S/c1-3-31-23(29)21-19(13-32(30)15-7-5-4-6-8-15)26(2)18-11-17(24)22(28)16(20(18)21)12-27-10-9-25-14-27;1-5(2,3)4/h4-11,14,28H,3,12-13H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | YXYSRRKRJKQPLO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 160.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|