C28H37BrN2O5S — CID 59820760
ethyl 2-(1-adamantylsulfinylmethyl)-6-bromo-5-hydroxy-1-methyl-4-(morpholin-4-ylmethyl)indole-3-carboxylate (PubChem CID 59820760) has the molecular formula C28H37BrN2O5S and a molecular weight of 593.58 g/mol. Its IUPAC name is ethyl 2-(1-adamantylsulfinylmethyl)-6-bromo-5-hydroxy-1-methyl-4-(morpholin-4-ylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 2-(1-adamantylsulfinylmethyl)-6-bromo-5-hydroxy-1-methyl-4-(morpholin-4-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 59820760 |
| Molecular Formula | C28H37BrN2O5S |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | ethyl 2-(1-adamantylsulfinylmethyl)-6-bromo-5-hydroxy-1-methyl-4-(morpholin-4-ylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CS(=O)C23CC4CC(CC(C4)C2)C3)n(C)c2cc(Br)c(O)c(CN3CCOCC3)c12 |
| InChI | InChI=1S/C28H37BrN2O5S/c1-3-36-27(33)25-23(16-37(34)28-12-17-8-18(13-28)10-19(9-17)14-28)30(2)22-11-21(29)26(32)20(24(22)25)15-31-4-6-35-7-5-31/h11,17-19,32H,3-10,12-16H2,1-2H3 |
| InChIKey | KJFQRDTZTMBBFA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|