C20H19BrN2O5 — CID 1040352
ethyl 6-bromo-5-hydroxy-4-(methoxycarbonylamino)-2-methyl-1-phenylindole-3-carboxylate (PubChem CID 1040352) has the molecular formula C20H19BrN2O5 and a molecular weight of 447.29 g/mol. Its IUPAC name is ethyl 6-bromo-5-hydroxy-4-(methoxycarbonylamino)-2-methyl-1-phenylindole-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-hydroxy-4-(methoxycarbonylamino)-2-methyl-1-phenylindole-3-carboxylate |
|---|---|
| PubChem CID | 1040352 |
| Molecular Formula | C20H19BrN2O5 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | ethyl 6-bromo-5-hydroxy-4-(methoxycarbonylamino)-2-methyl-1-phenylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccccc2)c2cc(Br)c(O)c(NC(=O)OC)c12 |
| InChI | InChI=1S/C20H19BrN2O5/c1-4-28-19(25)15-11(2)23(12-8-6-5-7-9-12)14-10-13(21)18(24)17(16(14)15)22-20(26)27-3/h5-10,24H,4H2,1-3H3,(H,22,26) |
| InChIKey | ABEOTFAZXJFDSC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|