C24H19BrClN3O3 — CID 135539117
ethyl 6-bromo-1-(3-chlorophenyl)-5-hydroxy-2-methyl-4-phenyldiazenylindole-3-carboxylate (PubChem CID 135539117) has the molecular formula C24H19BrClN3O3 and a molecular weight of 512.79 g/mol. Its IUPAC name is ethyl 6-bromo-1-(3-chlorophenyl)-5-hydroxy-2-methyl-4-phenyldiazenylindole-3-carboxylate.
| Compound Name | ethyl 6-bromo-1-(3-chlorophenyl)-5-hydroxy-2-methyl-4-phenyldiazenylindole-3-carboxylate |
|---|---|
| PubChem CID | 135539117 |
| Molecular Formula | C24H19BrClN3O3 |
| Molecular Weight | 512.79 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | ethyl 6-bromo-1-(3-chlorophenyl)-5-hydroxy-2-methyl-4-phenyldiazenylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2cccc(Cl)c2)c2cc(Br)c(O)c(/N=N/c3ccccc3)c12 |
| InChI | InChI=1S/C24H19BrClN3O3/c1-3-32-24(31)20-14(2)29(17-11-7-8-15(26)12-17)19-13-18(25)23(30)22(21(19)20)28-27-16-9-5-4-6-10-16/h4-13,30H,3H2,1-2H3/b28-27+ |
| InChIKey | ABSSBUWCRBQPIT-BYYHNAKLSA-N |
| XLogP | 7.65 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.79 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|