C26H22ClNO4 — CID 23992877
ethyl 1-(3-chlorophenyl)-2-methyl-5-phenacyloxyindole-3-carboxylate (PubChem CID 23992877) has the molecular formula C26H22ClNO4 and a molecular weight of 447.92 g/mol. Its IUPAC name is ethyl 1-(3-chlorophenyl)-2-methyl-5-phenacyloxyindole-3-carboxylate.
| Compound Name | ethyl 1-(3-chlorophenyl)-2-methyl-5-phenacyloxyindole-3-carboxylate |
|---|---|
| PubChem CID | 23992877 |
| Molecular Formula | C26H22ClNO4 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | ethyl 1-(3-chlorophenyl)-2-methyl-5-phenacyloxyindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2cccc(Cl)c2)c2ccc(OCC(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C26H22ClNO4/c1-3-31-26(30)25-17(2)28(20-11-7-10-19(27)14-20)23-13-12-21(15-22(23)25)32-16-24(29)18-8-5-4-6-9-18/h4-15H,3,16H2,1-2H3 |
| InChIKey | ZXCNDSVREMALOX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |