C24H27NO6 — CID 1038232
ethyl 5-(2-ethoxy-2-oxoethoxy)-1-(4-ethoxyphenyl)-2-methylindole-3-carboxylate (PubChem CID 1038232) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is ethyl 5-(2-ethoxy-2-oxoethoxy)-1-(4-ethoxyphenyl)-2-methylindole-3-carboxylate.
| Compound Name | ethyl 5-(2-ethoxy-2-oxoethoxy)-1-(4-ethoxyphenyl)-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 1038232 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | ethyl 5-(2-ethoxy-2-oxoethoxy)-1-(4-ethoxyphenyl)-2-methylindole-3-carboxylate |
| SMILES | CCOC(=O)COc1ccc2c(c1)c(C(=O)OCC)c(C)n2-c1ccc(OCC)cc1 |
| InChI | InChI=1S/C24H27NO6/c1-5-28-18-10-8-17(9-11-18)25-16(4)23(24(27)30-7-3)20-14-19(12-13-21(20)25)31-15-22(26)29-6-2/h8-14H,5-7,15H2,1-4H3 |
| InChIKey | PYRRKXZRUUMMSE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |