C22H18N2O4 — CID 15420181
ethyl 4-hydroxy-2-methyl-5-nitroso-1-phenylbenzo[g]indole-3-carboxylate (PubChem CID 15420181) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-methyl-5-nitroso-1-phenylbenzo[g]indole-3-carboxylate.
| Compound Name | ethyl 4-hydroxy-2-methyl-5-nitroso-1-phenylbenzo[g]indole-3-carboxylate |
|---|---|
| PubChem CID | 15420181 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl 4-hydroxy-2-methyl-5-nitroso-1-phenylbenzo[g]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccccc2)c2c1c(O)c(N=O)c1ccccc12 |
| InChI | InChI=1S/C22H18N2O4/c1-3-28-22(26)17-13(2)24(14-9-5-4-6-10-14)20-16-12-8-7-11-15(16)19(23-27)21(25)18(17)20/h4-12,25H,3H2,1-2H3 |
| InChIKey | DNZSWXHZHWSGAZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |