C31H27NO4 — CID 3444588
ethyl 5-(3,5-dimethylbenzoyl)oxy-2-methyl-1-phenylbenzo[g]indole-3-carboxylate (PubChem CID 3444588) has the molecular formula C31H27NO4 and a molecular weight of 477.56 g/mol. Its IUPAC name is ethyl 5-(3,5-dimethylbenzoyl)oxy-2-methyl-1-phenylbenzo[g]indole-3-carboxylate.
| Compound Name | ethyl 5-(3,5-dimethylbenzoyl)oxy-2-methyl-1-phenylbenzo[g]indole-3-carboxylate |
|---|---|
| PubChem CID | 3444588 |
| Molecular Formula | C31H27NO4 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | ethyl 5-(3,5-dimethylbenzoyl)oxy-2-methyl-1-phenylbenzo[g]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccccc2)c2c1cc(OC(=O)c1cc(C)cc(C)c1)c1ccccc12 |
| InChI | InChI=1S/C31H27NO4/c1-5-35-31(34)28-21(4)32(23-11-7-6-8-12-23)29-25-14-10-9-13-24(25)27(18-26(28)29)36-30(33)22-16-19(2)15-20(3)17-22/h6-18H,5H2,1-4H3 |
| InChIKey | QYEDOUBQYQPFCE-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|