C25H25N2O3- — CID 3548393
1-[4-(diethylamino)phenyl]-5-methoxy-2-methylbenzo[g]indole-3-carboxylate (PubChem CID 3548393) has the molecular formula C25H25N2O3- and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-5-methoxy-2-methylbenzo[g]indole-3-carboxylate.
| Compound Name | 1-[4-(diethylamino)phenyl]-5-methoxy-2-methylbenzo[g]indole-3-carboxylate |
|---|---|
| PubChem CID | 3548393 |
| Molecular Formula | C25H25N2O3- |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-5-methoxy-2-methylbenzo[g]indole-3-carboxylate |
| SMILES | CCN(CC)c1ccc(-n2c(C)c(C(=O)[O-])c3cc(OC)c4ccccc4c32)cc1 |
| InChI | InChI=1S/C25H26N2O3/c1-5-26(6-2)17-11-13-18(14-12-17)27-16(3)23(25(28)29)21-15-22(30-4)19-9-7-8-10-20(19)24(21)27/h7-15H,5-6H2,1-4H3,(H,28,29)/p-1 |
| InChIKey | JSIZYELYOAHYCX-UHFFFAOYSA-M |
| XLogP | 4.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|