C20H23NO6S — CID 11395614
ethyl 5-methoxy-2-methyl-1-(2-methylsulfonyloxyethyl)benzo[g]indole-3-carboxylate (PubChem CID 11395614) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is ethyl 5-methoxy-2-methyl-1-(2-methylsulfonyloxyethyl)benzo[g]indole-3-carboxylate.
| Compound Name | ethyl 5-methoxy-2-methyl-1-(2-methylsulfonyloxyethyl)benzo[g]indole-3-carboxylate |
|---|---|
| PubChem CID | 11395614 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | ethyl 5-methoxy-2-methyl-1-(2-methylsulfonyloxyethyl)benzo[g]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(CCOS(C)(=O)=O)c2c1cc(OC)c1ccccc12 |
| InChI | InChI=1S/C20H23NO6S/c1-5-26-20(22)18-13(2)21(10-11-27-28(4,23)24)19-15-9-7-6-8-14(15)17(25-3)12-16(18)19/h6-9,12H,5,10-11H2,1-4H3 |
| InChIKey | CZFCUXBBXKZQFC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|