C27H29NO6 — CID 16765460
2-methoxyethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-hydroxy-2-methylbenzo[g]indole-3-carboxylate (PubChem CID 16765460) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-methoxyethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-hydroxy-2-methylbenzo[g]indole-3-carboxylate.
| Compound Name | 2-methoxyethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-hydroxy-2-methylbenzo[g]indole-3-carboxylate |
|---|---|
| PubChem CID | 16765460 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-methoxyethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-hydroxy-2-methylbenzo[g]indole-3-carboxylate |
| SMILES | COCCOC(=O)c1c(C)n(CCc2ccc(OC)c(OC)c2)c2c1cc(O)c1ccccc12 |
| InChI | InChI=1S/C27H29NO6/c1-17-25(27(30)34-14-13-31-2)21-16-22(29)19-7-5-6-8-20(19)26(21)28(17)12-11-18-9-10-23(32-3)24(15-18)33-4/h5-10,15-16,29H,11-14H2,1-4H3 |
| InChIKey | SDYMVNGLOPOMEW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|