C26H27ClN3O6- — CID 163130982
2-methoxyethyl 1-[3-[2-chloro-4-[hydroxy(oxido)amino]anilino]propyl]-5-hydroxy-2-methylbenzo[g]indole-3-carboxylate (PubChem CID 163130982) has the molecular formula C26H27ClN3O6- and a molecular weight of 512.97 g/mol. Its IUPAC name is 2-methoxyethyl 1-[3-[2-chloro-4-[hydroxy(oxido)amino]anilino]propyl]-5-hydroxy-2-methylbenzo[g]indole-3-carboxylate.
| Compound Name | 2-methoxyethyl 1-[3-[2-chloro-4-[hydroxy(oxido)amino]anilino]propyl]-5-hydroxy-2-methylbenzo[g]indole-3-carboxylate |
|---|---|
| PubChem CID | 163130982 |
| Molecular Formula | C26H27ClN3O6- |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 2-methoxyethyl 1-[3-[2-chloro-4-[hydroxy(oxido)amino]anilino]propyl]-5-hydroxy-2-methylbenzo[g]indole-3-carboxylate |
| SMILES | COCCOC(=O)c1c(C)n(CCCNc2ccc(N([O-])O)cc2Cl)c2c1cc(O)c1ccccc12 |
| InChI | InChI=1S/C26H27ClN3O6/c1-16-24(26(32)36-13-12-35-2)20-15-23(31)18-6-3-4-7-19(18)25(20)29(16)11-5-10-28-22-9-8-17(30(33)34)14-21(22)27/h3-4,6-9,14-15,28,31,33H,5,10-13H2,1-2H3/q-1 |
| InChIKey | OPNDPMUGSHMGTQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|