C22H27NO2S — CID 46866931
S-tert-butyl 1-butyl-5-hydroxy-2-methylbenzo[g]indole-3-carbothioate (PubChem CID 46866931) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is S-tert-butyl 1-butyl-5-hydroxy-2-methylbenzo[g]indole-3-carbothioate.
| Compound Name | S-tert-butyl 1-butyl-5-hydroxy-2-methylbenzo[g]indole-3-carbothioate |
|---|---|
| PubChem CID | 46866931 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | S-tert-butyl 1-butyl-5-hydroxy-2-methylbenzo[g]indole-3-carbothioate |
| SMILES | CCCCn1c(C)c(C(=O)SC(C)(C)C)c2cc(O)c3ccccc3c21 |
| InChI | InChI=1S/C22H27NO2S/c1-6-7-12-23-14(2)19(21(25)26-22(3,4)5)17-13-18(24)15-10-8-9-11-16(15)20(17)23/h8-11,13,24H,6-7,12H2,1-5H3 |
| InChIKey | QCCORWGAFBKTTJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|