C21H23ClN2O4 — CID 143367604
2-[6-chloro-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-hydroxy-2-methylindol-3-yl]acetamide (PubChem CID 143367604) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-[6-chloro-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-hydroxy-2-methylindol-3-yl]acetamide.
| Compound Name | 2-[6-chloro-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-hydroxy-2-methylindol-3-yl]acetamide |
|---|---|
| PubChem CID | 143367604 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[6-chloro-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-hydroxy-2-methylindol-3-yl]acetamide |
| SMILES | COc1ccc(CCn2c(C)c(CC(N)=O)c3cc(O)c(Cl)cc32)cc1OC |
| InChI | InChI=1S/C21H23ClN2O4/c1-12-14(10-21(23)26)15-9-18(25)16(22)11-17(15)24(12)7-6-13-4-5-19(27-2)20(8-13)28-3/h4-5,8-9,11,25H,6-7,10H2,1-3H3,(H2,23,26) |
| InChIKey | MKWXPOJMTXKJPN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|