C14H16NNaO6S — CID 23704335
sodium 3-ethoxycarbonyl-5-methoxy-1,2-dimethylindole-6-sulfonate (PubChem CID 23704335) has the molecular formula C14H16NNaO6S and a molecular weight of 349.34 g/mol. Its IUPAC name is sodium 3-ethoxycarbonyl-5-methoxy-1,2-dimethylindole-6-sulfonate.
| Compound Name | sodium 3-ethoxycarbonyl-5-methoxy-1,2-dimethylindole-6-sulfonate |
|---|---|
| PubChem CID | 23704335 |
| Molecular Formula | C14H16NNaO6S |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | sodium 3-ethoxycarbonyl-5-methoxy-1,2-dimethylindole-6-sulfonate |
| SMILES | CCOC(=O)c1c(C)n(C)c2cc(S(=O)(=O)[O-])c(OC)cc12.[Na+] |
| InChI | InChI=1S/C14H17NO6S.Na/c1-5-21-14(16)13-8(2)15(3)10-7-12(22(17,18)19)11(20-4)6-9(10)13;/h6-7H,5H2,1-4H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | UBEVGKGSCKHTAO-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 97.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|