C29H27NO5 — CID 175423520
ethyl 5-[3-[3-(2-methoxyphenyl)prop-2-enoyl]phenoxy]-1,2-dimethylindole-3-carboxylate (PubChem CID 175423520) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is ethyl 5-[3-[3-(2-methoxyphenyl)prop-2-enoyl]phenoxy]-1,2-dimethylindole-3-carboxylate.
| Compound Name | ethyl 5-[3-[3-(2-methoxyphenyl)prop-2-enoyl]phenoxy]-1,2-dimethylindole-3-carboxylate |
|---|---|
| PubChem CID | 175423520 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | ethyl 5-[3-[3-(2-methoxyphenyl)prop-2-enoyl]phenoxy]-1,2-dimethylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C)c2ccc(Oc3cccc(C(=O)C=Cc4ccccc4OC)c3)cc12 |
| InChI | InChI=1S/C29H27NO5/c1-5-34-29(32)28-19(2)30(3)25-15-14-23(18-24(25)28)35-22-11-8-10-21(17-22)26(31)16-13-20-9-6-7-12-27(20)33-4/h6-18H,5H2,1-4H3 |
| InChIKey | XCKKCCFFYKNSJT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|