C33H35NO6 — CID 175423471
ethyl 5-[4-[4-[3-(4-methoxyphenyl)prop-2-enoyl]phenoxy]butoxy]-1,2-dimethylindole-3-carboxylate (PubChem CID 175423471) has the molecular formula C33H35NO6 and a molecular weight of 541.64 g/mol. Its IUPAC name is ethyl 5-[4-[4-[3-(4-methoxyphenyl)prop-2-enoyl]phenoxy]butoxy]-1,2-dimethylindole-3-carboxylate.
| Compound Name | ethyl 5-[4-[4-[3-(4-methoxyphenyl)prop-2-enoyl]phenoxy]butoxy]-1,2-dimethylindole-3-carboxylate |
|---|---|
| PubChem CID | 175423471 |
| Molecular Formula | C33H35NO6 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | ethyl 5-[4-[4-[3-(4-methoxyphenyl)prop-2-enoyl]phenoxy]butoxy]-1,2-dimethylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C)c2ccc(OCCCCOc3ccc(C(=O)C=Cc4ccc(OC)cc4)cc3)cc12 |
| InChI | InChI=1S/C33H35NO6/c1-5-38-33(36)32-23(2)34(3)30-18-17-28(22-29(30)32)40-21-7-6-20-39-27-15-11-25(12-16-27)31(35)19-10-24-8-13-26(37-4)14-9-24/h8-19,22H,5-7,20-21H2,1-4H3 |
| InChIKey | FLBBJQBOBBGFOE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|