C23H24BrClN2O2 — CID 155377349
ethyl 5-bromo-6-chloro-1-phenyl-3-(piperidin-1-ylmethyl)indole-2-carboxylate (PubChem CID 155377349) has the molecular formula C23H24BrClN2O2 and a molecular weight of 475.81 g/mol. Its IUPAC name is ethyl 5-bromo-6-chloro-1-phenyl-3-(piperidin-1-ylmethyl)indole-2-carboxylate.
| Compound Name | ethyl 5-bromo-6-chloro-1-phenyl-3-(piperidin-1-ylmethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 155377349 |
| Molecular Formula | C23H24BrClN2O2 |
| Molecular Weight | 475.81 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | ethyl 5-bromo-6-chloro-1-phenyl-3-(piperidin-1-ylmethyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(CN2CCCCC2)c2cc(Br)c(Cl)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H24BrClN2O2/c1-2-29-23(28)22-18(15-26-11-7-4-8-12-26)17-13-19(24)20(25)14-21(17)27(22)16-9-5-3-6-10-16/h3,5-6,9-10,13-14H,2,4,7-8,11-12,15H2,1H3 |
| InChIKey | WWUKNOJDOZNWET-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.81 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |