C22H22F2N2O2 — CID 155367665
ethyl 5,6-difluoro-1-phenyl-3-piperidin-1-ylindole-2-carboxylate (PubChem CID 155367665) has the molecular formula C22H22F2N2O2 and a molecular weight of 384.43 g/mol. Its IUPAC name is ethyl 5,6-difluoro-1-phenyl-3-piperidin-1-ylindole-2-carboxylate.
| Compound Name | ethyl 5,6-difluoro-1-phenyl-3-piperidin-1-ylindole-2-carboxylate |
|---|---|
| PubChem CID | 155367665 |
| Molecular Formula | C22H22F2N2O2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | ethyl 5,6-difluoro-1-phenyl-3-piperidin-1-ylindole-2-carboxylate |
| SMILES | CCOC(=O)c1c(N2CCCCC2)c2cc(F)c(F)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C22H22F2N2O2/c1-2-28-22(27)21-20(25-11-7-4-8-12-25)16-13-17(23)18(24)14-19(16)26(21)15-9-5-3-6-10-15/h3,5-6,9-10,13-14H,2,4,7-8,11-12H2,1H3 |
| InChIKey | DSUXQEPJSBEWRZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |