C32H31F3N2O6 — CID 66657519
ethyl 2-(2-ethoxy-2-oxoethyl)-1-(4-morpholin-4-ylphenyl)-5-[4-(trifluoromethyl)phenoxy]indole-3-carboxylate (PubChem CID 66657519) has the molecular formula C32H31F3N2O6 and a molecular weight of 596.60 g/mol. Its IUPAC name is ethyl 2-(2-ethoxy-2-oxoethyl)-1-(4-morpholin-4-ylphenyl)-5-[4-(trifluoromethyl)phenoxy]indole-3-carboxylate.
| Compound Name | ethyl 2-(2-ethoxy-2-oxoethyl)-1-(4-morpholin-4-ylphenyl)-5-[4-(trifluoromethyl)phenoxy]indole-3-carboxylate |
|---|---|
| PubChem CID | 66657519 |
| Molecular Formula | C32H31F3N2O6 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | ethyl 2-(2-ethoxy-2-oxoethyl)-1-(4-morpholin-4-ylphenyl)-5-[4-(trifluoromethyl)phenoxy]indole-3-carboxylate |
| SMILES | CCOC(=O)Cc1c(C(=O)OCC)c2cc(Oc3ccc(C(F)(F)F)cc3)ccc2n1-c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C32H31F3N2O6/c1-3-41-29(38)20-28-30(31(39)42-4-2)26-19-25(43-24-11-5-21(6-12-24)32(33,34)35)13-14-27(26)37(28)23-9-7-22(8-10-23)36-15-17-40-18-16-36/h5-14,19H,3-4,15-18,20H2,1-2H3 |
| InChIKey | AAOABYRGXKTTAT-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|