C27H25F3N2O3 — CID 141151399
ethyl 2-[1-[4-(dimethylamino)phenyl]-5-[4-(trifluoromethyl)phenoxy]indol-2-yl]acetate (PubChem CID 141151399) has the molecular formula C27H25F3N2O3 and a molecular weight of 482.50 g/mol. Its IUPAC name is ethyl 2-[1-[4-(dimethylamino)phenyl]-5-[4-(trifluoromethyl)phenoxy]indol-2-yl]acetate.
| Compound Name | ethyl 2-[1-[4-(dimethylamino)phenyl]-5-[4-(trifluoromethyl)phenoxy]indol-2-yl]acetate |
|---|---|
| PubChem CID | 141151399 |
| Molecular Formula | C27H25F3N2O3 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | ethyl 2-[1-[4-(dimethylamino)phenyl]-5-[4-(trifluoromethyl)phenoxy]indol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cc2cc(Oc3ccc(C(F)(F)F)cc3)ccc2n1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C27H25F3N2O3/c1-4-34-26(33)17-22-15-18-16-24(35-23-11-5-19(6-12-23)27(28,29)30)13-14-25(18)32(22)21-9-7-20(8-10-21)31(2)3/h5-16H,4,17H2,1-3H3 |
| InChIKey | XXHGPVLRMTWPRU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|