C26H25N3O6 — CID 141151394
ethyl 2-[5-[(5-nitro-2-pyridinyl)oxy]-1-(4-propan-2-yloxyphenyl)indol-2-yl]acetate (PubChem CID 141151394) has the molecular formula C26H25N3O6 and a molecular weight of 475.50 g/mol. Its IUPAC name is ethyl 2-[5-[(5-nitro-2-pyridinyl)oxy]-1-(4-propan-2-yloxyphenyl)indol-2-yl]acetate.
| Compound Name | ethyl 2-[5-[(5-nitro-2-pyridinyl)oxy]-1-(4-propan-2-yloxyphenyl)indol-2-yl]acetate |
|---|---|
| PubChem CID | 141151394 |
| Molecular Formula | C26H25N3O6 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | ethyl 2-[5-[(5-nitro-2-pyridinyl)oxy]-1-(4-propan-2-yloxyphenyl)indol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cc2cc(Oc3ccc([N+](=O)[O-])cn3)ccc2n1-c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C26H25N3O6/c1-4-33-26(30)15-21-13-18-14-23(35-25-12-7-20(16-27-25)29(31)32)10-11-24(18)28(21)19-5-8-22(9-6-19)34-17(2)3/h5-14,16-17H,4,15H2,1-3H3 |
| InChIKey | HSVNLHGTNGLRPP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|