C26H23N3O8 — CID 66658109
dimethyl 5-[(5-nitro-2-pyridinyl)oxy]-1-(4-propan-2-yloxyphenyl)indole-2,3-dicarboxylate (PubChem CID 66658109) has the molecular formula C26H23N3O8 and a molecular weight of 505.48 g/mol. Its IUPAC name is dimethyl 5-[(5-nitro-2-pyridinyl)oxy]-1-(4-propan-2-yloxyphenyl)indole-2,3-dicarboxylate.
| Compound Name | dimethyl 5-[(5-nitro-2-pyridinyl)oxy]-1-(4-propan-2-yloxyphenyl)indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 66658109 |
| Molecular Formula | C26H23N3O8 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | dimethyl 5-[(5-nitro-2-pyridinyl)oxy]-1-(4-propan-2-yloxyphenyl)indole-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)n(-c2ccc(OC(C)C)cc2)c2ccc(Oc3ccc([N+](=O)[O-])cn3)cc12 |
| InChI | InChI=1S/C26H23N3O8/c1-15(2)36-18-8-5-16(6-9-18)28-21-11-10-19(37-22-12-7-17(14-27-22)29(32)33)13-20(21)23(25(30)34-3)24(28)26(31)35-4/h5-15H,1-4H3 |
| InChIKey | LVTGCVUIEUIIKW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 132.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|