C18H18N2O5 — CID 86673387
ethyl (E)-3-[3,5-dimethyl-4-[(5-nitro-2-pyridinyl)oxy]phenyl]prop-2-enoate (PubChem CID 86673387) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is ethyl (E)-3-[3,5-dimethyl-4-[(5-nitro-2-pyridinyl)oxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3,5-dimethyl-4-[(5-nitro-2-pyridinyl)oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86673387 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | ethyl (E)-3-[3,5-dimethyl-4-[(5-nitro-2-pyridinyl)oxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(C)c(Oc2ccc([N+](=O)[O-])cn2)c(C)c1 |
| InChI | InChI=1S/C18H18N2O5/c1-4-24-17(21)8-5-14-9-12(2)18(13(3)10-14)25-16-7-6-15(11-19-16)20(22)23/h5-11H,4H2,1-3H3/b8-5+ |
| InChIKey | MLWXDLCMWDZMRG-VMPITWQZSA-N |
| XLogP | 3.98 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|