About ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol
ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol (PubChem CID 143113738) has the molecular formula C26H28F3NO3
and a molecular weight of 459.51 g/mol. Its IUPAC name is ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol.
Molecular Properties
| Compound Name | ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol |
| PubChem CID | 143113738 |
| Molecular Formula | C26H28F3NO3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol |
| SMILES | CC.CO.OCc1cc2cc(OCc3ccccc3)ccc2n1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H18F3NO2.C2H6.CH4O/c24-23(25,26)18-6-8-19(9-7-18)27-20(14-28)12-17-13-21(10-11-22(17)27)29-15-16-4-2-1-3-5-16;2*1-2/h1-13,28H,14-15H2;1-2H3;2H,1H3 |
| InChIKey | JBMATVHCBIWGRF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol?
The IUPAC name of ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol (CID 143113738) is ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol.
What is the SMILES notation for ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol?
The canonical SMILES for ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol is CC.CO.OCc1cc2cc(OCc3ccccc3)ccc2n1-c1ccc(C(F)(F)F)cc1.
What is the InChIKey of ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol?
The InChIKey is JBMATVHCBIWGRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F3NO2.C2H6.CH4O/c24-23(25,26)18-6-8-19(9-7-18)27-20(14-28)12-17-13-21(10-11-22(17)27)29-15-16-4-2-1-3-5-16;2*1-2/h1-13,28H,14-15H2;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol?
ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol has a molecular weight of 459.51 g/mol, XLogP of 6.36, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;[5-phenylmethoxy-1-[4-(trifluoromethyl)phenyl]indol-2-yl]methanol is sourced from PubChem (CID 143113738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).