C25H30N2O3 — CID 2279297
1-[5-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]-2-methyl-1-phenylindol-3-yl]ethanone (PubChem CID 2279297) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[5-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]-2-methyl-1-phenylindol-3-yl]ethanone.
| Compound Name | 1-[5-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]-2-methyl-1-phenylindol-3-yl]ethanone |
|---|---|
| PubChem CID | 2279297 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 1-[5-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]-2-methyl-1-phenylindol-3-yl]ethanone |
| SMILES | CC(=O)c1c(C)n(-c2ccccc2)c2ccc(OC[C@H](O)CN3CCCCC3)cc12 |
| InChI | InChI=1S/C25H30N2O3/c1-18-25(19(2)28)23-15-22(30-17-21(29)16-26-13-7-4-8-14-26)11-12-24(23)27(18)20-9-5-3-6-10-20/h3,5-6,9-12,15,21,29H,4,7-8,13-14,16-17H2,1-2H3/t21-/m1/s1 |
| InChIKey | ZWJOSWADMBBFKV-OAQYLSRUSA-N |
| XLogP | 4.37 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |