C25H31N2O3+ — CID 2279298
1-[5-[(2S)-2-hydroxy-3-piperidin-1-ium-1-ylpropoxy]-2-methyl-1-phenylindol-3-yl]ethanone (PubChem CID 2279298) has the molecular formula C25H31N2O3+ and a molecular weight of 407.53 g/mol. Its IUPAC name is 1-[5-[(2S)-2-hydroxy-3-piperidin-1-ium-1-ylpropoxy]-2-methyl-1-phenylindol-3-yl]ethanone.
| Compound Name | 1-[5-[(2S)-2-hydroxy-3-piperidin-1-ium-1-ylpropoxy]-2-methyl-1-phenylindol-3-yl]ethanone |
|---|---|
| PubChem CID | 2279298 |
| Molecular Formula | C25H31N2O3+ |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-[5-[(2S)-2-hydroxy-3-piperidin-1-ium-1-ylpropoxy]-2-methyl-1-phenylindol-3-yl]ethanone |
| SMILES | CC(=O)c1c(C)n(-c2ccccc2)c2ccc(OC[C@@H](O)C[NH+]3CCCCC3)cc12 |
| InChI | InChI=1S/C25H30N2O3/c1-18-25(19(2)28)23-15-22(30-17-21(29)16-26-13-7-4-8-14-26)11-12-24(23)27(18)20-9-5-3-6-10-20/h3,5-6,9-12,15,21,29H,4,7-8,13-14,16-17H2,1-2H3/p+1/t21-/m0/s1 |
| InChIKey | ZWJOSWADMBBFKV-NRFANRHFSA-O |
| XLogP | 2.95 |
| TPSA | 55.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |