C27H26N4O3S — CID 10005646
1-[[2-[3-acetyl-2-methyl-1-(4-methylphenyl)indol-5-yl]oxyacetyl]amino]-3-phenylthiourea (PubChem CID 10005646) has the molecular formula C27H26N4O3S and a molecular weight of 486.60 g/mol. Its IUPAC name is 1-[[2-[3-acetyl-2-methyl-1-(4-methylphenyl)indol-5-yl]oxyacetyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[2-[3-acetyl-2-methyl-1-(4-methylphenyl)indol-5-yl]oxyacetyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 10005646 |
| Molecular Formula | C27H26N4O3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 1-[[2-[3-acetyl-2-methyl-1-(4-methylphenyl)indol-5-yl]oxyacetyl]amino]-3-phenylthiourea |
| SMILES | CC(=O)c1c(C)n(-c2ccc(C)cc2)c2ccc(OCC(=O)NNC(=S)Nc3ccccc3)cc12 |
| InChI | InChI=1S/C27H26N4O3S/c1-17-9-11-21(12-10-17)31-18(2)26(19(3)32)23-15-22(13-14-24(23)31)34-16-25(33)29-30-27(35)28-20-7-5-4-6-8-20/h4-15H,16H2,1-3H3,(H,29,33)(H2,28,30,35) |
| InChIKey | AIYUGGVPLAQWEB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|