C30H42N2O5 — CID 71292250
butyl 2,4-dibutoxy-5-ethyl-6-(6-methoxy-1-methylindol-2-yl)pyridine-3-carboxylate (PubChem CID 71292250) has the molecular formula C30H42N2O5 and a molecular weight of 510.68 g/mol. Its IUPAC name is butyl 2,4-dibutoxy-5-ethyl-6-(6-methoxy-1-methylindol-2-yl)pyridine-3-carboxylate.
| Compound Name | butyl 2,4-dibutoxy-5-ethyl-6-(6-methoxy-1-methylindol-2-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 71292250 |
| Molecular Formula | C30H42N2O5 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | butyl 2,4-dibutoxy-5-ethyl-6-(6-methoxy-1-methylindol-2-yl)pyridine-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(OCCCC)nc(-c2cc3ccc(OC)cc3n2C)c(CC)c1OCCCC |
| InChI | InChI=1S/C30H42N2O5/c1-7-11-16-35-28-23(10-4)27(25-19-21-14-15-22(34-6)20-24(21)32(25)5)31-29(36-17-12-8-2)26(28)30(33)37-18-13-9-3/h14-15,19-20H,7-13,16-18H2,1-6H3 |
| InChIKey | TXISSPJGKIKBJD-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|