5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid

C14H12N2O4 — CID 115108015

IUPAC5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid
SMILESCOc1ccc2cc(-c3cc(C(=O)O)no3)n(C)c2c1
InChIInChI=1S/C14H12N2O4/c1-16-11-6-9(19-2)4-3-8(11)5-12(16)13-7-10(14(17)18)15-20-13/h3-7H,1-2H3,(H,17,18)
InChIKeyVJOZUQAXMJCHNS-UHFFFAOYSA-N
MW272.26 g/mol
LogP2.54
Rot. Bonds3

About 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid

5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 115108015) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid
PubChem CID115108015
Molecular FormulaC14H12N2O4
Molecular Weight272.26 g/mol
Exact Mass272.08
IUPAC Name5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid
SMILESCOc1ccc2cc(-c3cc(C(=O)O)no3)n(C)c2c1
InChIInChI=1S/C14H12N2O4/c1-16-11-6-9(19-2)4-3-8(11)5-12(16)13-7-10(14(17)18)15-20-13/h3-7H,1-2H3,(H,17,18)
InChIKeyVJOZUQAXMJCHNS-UHFFFAOYSA-N
XLogP2.54
TPSA77.49 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.26
LogP ≤ 52.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid (CID 115108015) is 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid is COc1ccc2cc(-c3cc(C(=O)O)no3)n(C)c2c1.
What is the InChIKey of 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is VJOZUQAXMJCHNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O4/c1-16-11-6-9(19-2)4-3-8(11)5-12(16)13-7-10(14(17)18)15-20-13/h3-7H,1-2H3,(H,17,18).
What are the key properties of 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid?
5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 272.26 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-methoxy-1-methylindol-2-yl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 115108015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).