C14H12N2O4 — CID 115109391
5-(5-methoxy-1-methylindol-2-yl)-1,2-oxazole-4-carboxylic acid (PubChem CID 115109391) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-(5-methoxy-1-methylindol-2-yl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-(5-methoxy-1-methylindol-2-yl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115109391 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-(5-methoxy-1-methylindol-2-yl)-1,2-oxazole-4-carboxylic acid |
| SMILES | COc1ccc2c(c1)cc(-c1oncc1C(=O)O)n2C |
| InChI | InChI=1S/C14H12N2O4/c1-16-11-4-3-9(19-2)5-8(11)6-12(16)13-10(14(17)18)7-15-20-13/h3-7H,1-2H3,(H,17,18) |
| InChIKey | SINZNPJNLCBPDK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |